혹시 molecular cafe(으)로 찾으셨나요?
블로그
- 우주 이야기 1646 - 초신성 잔해에서 발견된 아기 별 (Artist's impression of a hot core—a warm cocoon of molecular gas surrounding a newborn star—discovered represents high-energy regions produced by the supernova explosion, while brown indicates the surrounding molecular
- (R)-3C4HPG [CS-0020489][CAS no. 13861-03-5]_ChemScene - 코아사이언스 Molecular Formula: C₉H₉NO₅ Molecular Weight: 211.17 SMILES: OC1=C(C(O)=O)C=C([C@@H](N)C(O)=O)C=C1 * 본 Type 2 [IO-1, IO-2] MonoSpin Series - "Easy and Fast" small volume sample preparation column 코아사이언스 core